C10H15N3O3S — CID 136956662
4-[(1,1-dioxothian-3-yl)amino]-2-methyl-1H-pyrimidin-6-one (PubChem CID 136956662) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-3-yl)amino]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[(1,1-dioxothian-3-yl)amino]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956662 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-[(1,1-dioxothian-3-yl)amino]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NC2CCCS(=O)(=O)C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H15N3O3S/c1-7-11-9(5-10(14)12-7)13-8-3-2-4-17(15,16)6-8/h5,8H,2-4,6H2,1H3,(H2,11,12,13,14) |
| InChIKey | LDEGXZJQPPSCGE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |