C11H13ClN2O4S — CID 63922375
2-chloro-6-[(1,1-dioxothian-3-yl)amino]pyridine-4-carboxylic acid (PubChem CID 63922375) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.76 g/mol. Its IUPAC name is 2-chloro-6-[(1,1-dioxothian-3-yl)amino]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[(1,1-dioxothian-3-yl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 63922375 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-chloro-6-[(1,1-dioxothian-3-yl)amino]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)nc(NC2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C11H13ClN2O4S/c12-9-4-7(11(15)16)5-10(14-9)13-8-2-1-3-19(17,18)6-8/h4-5,8H,1-3,6H2,(H,13,14)(H,15,16) |
| InChIKey | YIUDUIKUXZBCHD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|