C13H17ClN2O2S — CID 114123522
2-chloro-6-[(2-methylsulfanylcyclohexyl)amino]pyridine-4-carboxylic acid (PubChem CID 114123522) has the molecular formula C13H17ClN2O2S and a molecular weight of 300.81 g/mol. Its IUPAC name is 2-chloro-6-[(2-methylsulfanylcyclohexyl)amino]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[(2-methylsulfanylcyclohexyl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114123522 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-chloro-6-[(2-methylsulfanylcyclohexyl)amino]pyridine-4-carboxylic acid |
| SMILES | CSC1CCCCC1Nc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C13H17ClN2O2S/c1-19-10-5-3-2-4-9(10)15-12-7-8(13(17)18)6-11(14)16-12/h6-7,9-10H,2-5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | LAFLRERXMPCFNQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|