C11H16ClN3S — CID 104924476
6-chloro-2-N-(2-methylsulfanylcyclopentyl)pyridine-2,4-diamine (PubChem CID 104924476) has the molecular formula C11H16ClN3S and a molecular weight of 257.79 g/mol. Its IUPAC name is 6-chloro-2-N-(2-methylsulfanylcyclopentyl)pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(2-methylsulfanylcyclopentyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 104924476 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 6-chloro-2-N-(2-methylsulfanylcyclopentyl)pyridine-2,4-diamine |
| SMILES | CSC1CCCC1Nc1cc(N)cc(Cl)n1 |
| InChI | InChI=1S/C11H16ClN3S/c1-16-9-4-2-3-8(9)14-11-6-7(13)5-10(12)15-11/h5-6,8-9H,2-4H2,1H3,(H3,13,14,15) |
| InChIKey | NGUWEXMLMWEIQW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|