C9H16N2O2S — CID 79504359
N-(1,1-dioxothian-3-yl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 79504359) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-(1,1-dioxothian-3-yl)-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 79504359 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | O=S1(=O)CCCC(NC2=NCCC2)C1 |
| InChI | InChI=1S/C9H16N2O2S/c12-14(13)6-2-3-8(7-14)11-9-4-1-5-10-9/h8H,1-7H2,(H,10,11) |
| InChIKey | RVKVRACEBOUQRY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |