C9H16N2O — CID 79503427
N-(oxan-3-yl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 79503427) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-(oxan-3-yl)-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-(oxan-3-yl)-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 79503427 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-(oxan-3-yl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | C1CN=C(NC2CCCOC2)C1 |
| InChI | InChI=1S/C9H16N2O/c1-4-9(10-5-1)11-8-3-2-6-12-7-8/h8H,1-7H2,(H,10,11) |
| InChIKey | SPNDRNLJHPYMSK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |