C8H11BrN4O2S — CID 80784885
5-bromo-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-2,4-diamine (PubChem CID 80784885) has the molecular formula C8H11BrN4O2S and a molecular weight of 307.17 g/mol. Its IUPAC name is 5-bromo-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80784885 |
| Molecular Formula | C8H11BrN4O2S |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 5-bromo-4-N-(1,1-dioxothiolan-3-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Br)c(NC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C8H11BrN4O2S/c9-6-3-11-8(10)13-7(6)12-5-1-2-16(14,15)4-5/h3,5H,1-2,4H2,(H3,10,11,12,13) |
| InChIKey | MPPOQTQHZQAGBZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |