C6H9N3O2S2 — CID 130816194
2-N-(1,1-dioxothietan-3-yl)-1,3-thiazole-2,5-diamine (PubChem CID 130816194) has the molecular formula C6H9N3O2S2 and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-N-(1,1-dioxothietan-3-yl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(1,1-dioxothietan-3-yl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 130816194 |
| Molecular Formula | C6H9N3O2S2 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 2-N-(1,1-dioxothietan-3-yl)-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(NC2CS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C6H9N3O2S2/c7-5-1-8-6(12-5)9-4-2-13(10,11)3-4/h1,4H,2-3,7H2,(H,8,9) |
| InChIKey | TTZJHZRBFFGQSU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |