C8H11N3O2S — CID 130948244
2-N-(1,1-dioxothietan-3-yl)pyridine-2,5-diamine (PubChem CID 130948244) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-N-(1,1-dioxothietan-3-yl)pyridine-2,5-diamine.
| Compound Name | 2-N-(1,1-dioxothietan-3-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 130948244 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-N-(1,1-dioxothietan-3-yl)pyridine-2,5-diamine |
| SMILES | Nc1ccc(NC2CS(=O)(=O)C2)nc1 |
| InChI | InChI=1S/C8H11N3O2S/c9-6-1-2-8(10-3-6)11-7-4-14(12,13)5-7/h1-3,7H,4-5,9H2,(H,10,11) |
| InChIKey | LRMYRNXALQLSLY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |