C12H20N4 — CID 114502996
2-N-(1,3-dimethylpiperidin-4-yl)pyridine-2,5-diamine (PubChem CID 114502996) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-N-(1,3-dimethylpiperidin-4-yl)pyridine-2,5-diamine.
| Compound Name | 2-N-(1,3-dimethylpiperidin-4-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 114502996 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 2-N-(1,3-dimethylpiperidin-4-yl)pyridine-2,5-diamine |
| SMILES | CC1CN(C)CCC1Nc1ccc(N)cn1 |
| InChI | InChI=1S/C12H20N4/c1-9-8-16(2)6-5-11(9)15-12-4-3-10(13)7-14-12/h3-4,7,9,11H,5-6,8,13H2,1-2H3,(H,14,15) |
| InChIKey | YJQNLXAYGZAAKH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |