C14H20N4 — CID 114503043
5-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]benzonitrile (PubChem CID 114503043) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 5-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]benzonitrile.
| Compound Name | 5-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 114503043 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 5-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]benzonitrile |
| SMILES | CC1CN(C)CCC1Nc1ccc(N)cc1C#N |
| InChI | InChI=1S/C14H20N4/c1-10-9-18(2)6-5-13(10)17-14-4-3-12(16)7-11(14)8-15/h3-4,7,10,13,17H,5-6,9,16H2,1-2H3 |
| InChIKey | SSKJSFDHWHICPL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|