C16H22N4 — CID 114502970
8-N-(1,3-dimethylpiperidin-4-yl)quinoline-5,8-diamine (PubChem CID 114502970) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 8-N-(1,3-dimethylpiperidin-4-yl)quinoline-5,8-diamine.
| Compound Name | 8-N-(1,3-dimethylpiperidin-4-yl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 114502970 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 8-N-(1,3-dimethylpiperidin-4-yl)quinoline-5,8-diamine |
| SMILES | CC1CN(C)CCC1Nc1ccc(N)c2cccnc12 |
| InChI | InChI=1S/C16H22N4/c1-11-10-20(2)9-7-14(11)19-15-6-5-13(17)12-4-3-8-18-16(12)15/h3-6,8,11,14,19H,7,9-10,17H2,1-2H3 |
| InChIKey | NFHUVQFMEXVMGZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|