C14H19F3N2 — CID 114504908
1,3-dimethyl-N-[2-(trifluoromethyl)phenyl]piperidin-4-amine (PubChem CID 114504908) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 1,3-dimethyl-N-[2-(trifluoromethyl)phenyl]piperidin-4-amine.
| Compound Name | 1,3-dimethyl-N-[2-(trifluoromethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 114504908 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1,3-dimethyl-N-[2-(trifluoromethyl)phenyl]piperidin-4-amine |
| SMILES | CC1CN(C)CCC1Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H19F3N2/c1-10-9-19(2)8-7-12(10)18-13-6-4-3-5-11(13)14(15,16)17/h3-6,10,12,18H,7-9H2,1-2H3 |
| InChIKey | GSTJRMVIAGJQDJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |