C15H21F3N2 — CID 43665342
1,2,5-trimethyl-N-[2-(trifluoromethyl)phenyl]piperidin-4-amine (PubChem CID 43665342) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 1,2,5-trimethyl-N-[2-(trifluoromethyl)phenyl]piperidin-4-amine.
| Compound Name | 1,2,5-trimethyl-N-[2-(trifluoromethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 43665342 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1,2,5-trimethyl-N-[2-(trifluoromethyl)phenyl]piperidin-4-amine |
| SMILES | CC1CN(C)C(C)CC1Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2/c1-10-9-20(3)11(2)8-14(10)19-13-7-5-4-6-12(13)15(16,17)18/h4-7,10-11,14,19H,8-9H2,1-3H3 |
| InChIKey | VNJIOUOBLOPSSH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |