C7H8ClN3O2S — CID 131209479
6-chloro-N-(1,1-dioxothietan-3-yl)pyridazin-4-amine (PubChem CID 131209479) has the molecular formula C7H8ClN3O2S and a molecular weight of 233.68 g/mol. Its IUPAC name is 6-chloro-N-(1,1-dioxothietan-3-yl)pyridazin-4-amine.
| Compound Name | 6-chloro-N-(1,1-dioxothietan-3-yl)pyridazin-4-amine |
|---|---|
| PubChem CID | 131209479 |
| Molecular Formula | C7H8ClN3O2S |
| Molecular Weight | 233.68 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 6-chloro-N-(1,1-dioxothietan-3-yl)pyridazin-4-amine |
| SMILES | O=S1(=O)CC(Nc2cnnc(Cl)c2)C1 |
| InChI | InChI=1S/C7H8ClN3O2S/c8-7-1-5(2-9-11-7)10-6-3-14(12,13)4-6/h1-2,6H,3-4H2,(H,10,11) |
| InChIKey | QCTOEFNQBBZKIW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.68 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |