C9H11BrN2S — CID 131154421
5-bromo-N-cyclohex-3-en-1-yl-1,3-thiazol-2-amine (PubChem CID 131154421) has the molecular formula C9H11BrN2S and a molecular weight of 259.17 g/mol. Its IUPAC name is 5-bromo-N-cyclohex-3-en-1-yl-1,3-thiazol-2-amine.
| Compound Name | 5-bromo-N-cyclohex-3-en-1-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 131154421 |
| Molecular Formula | C9H11BrN2S |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 5-bromo-N-cyclohex-3-en-1-yl-1,3-thiazol-2-amine |
| SMILES | Brc1cnc(NC2CC=CCC2)s1 |
| InChI | InChI=1S/C9H11BrN2S/c10-8-6-11-9(13-8)12-7-4-2-1-3-5-7/h1-2,6-7H,3-5H2,(H,11,12) |
| InChIKey | QSWZZLILTZWTMV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|