C10H12IN3 — CID 104843859
N-cyclohex-3-en-1-yl-5-iodopyrimidin-2-amine (PubChem CID 104843859) has the molecular formula C10H12IN3 and a molecular weight of 301.13 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-5-iodopyrimidin-2-amine.
| Compound Name | N-cyclohex-3-en-1-yl-5-iodopyrimidin-2-amine |
|---|---|
| PubChem CID | 104843859 |
| Molecular Formula | C10H12IN3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | N-cyclohex-3-en-1-yl-5-iodopyrimidin-2-amine |
| SMILES | Ic1cnc(NC2CC=CCC2)nc1 |
| InChI | InChI=1S/C10H12IN3/c11-8-6-12-10(13-7-8)14-9-4-2-1-3-5-9/h1-2,6-7,9H,3-5H2,(H,12,13,14) |
| InChIKey | VLKRZIBUHIZIGY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|