C11H14IN5 — CID 104843729
2-[4-[(5-iodopyrimidin-2-yl)amino]piperidin-1-yl]acetonitrile (PubChem CID 104843729) has the molecular formula C11H14IN5 and a molecular weight of 343.17 g/mol. Its IUPAC name is 2-[4-[(5-iodopyrimidin-2-yl)amino]piperidin-1-yl]acetonitrile.
| Compound Name | 2-[4-[(5-iodopyrimidin-2-yl)amino]piperidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 104843729 |
| Molecular Formula | C11H14IN5 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-[4-[(5-iodopyrimidin-2-yl)amino]piperidin-1-yl]acetonitrile |
| SMILES | N#CCN1CCC(Nc2ncc(I)cn2)CC1 |
| InChI | InChI=1S/C11H14IN5/c12-9-7-14-11(15-8-9)16-10-1-4-17(5-2-10)6-3-13/h7-8,10H,1-2,4-6H2,(H,14,15,16) |
| InChIKey | VYNIRXNTHOQFRV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|