C12H18IN3 — CID 116648422
N-(3,5-dimethylcyclohexyl)-5-iodopyrimidin-2-amine (PubChem CID 116648422) has the molecular formula C12H18IN3 and a molecular weight of 331.20 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-5-iodopyrimidin-2-amine.
| Compound Name | N-(3,5-dimethylcyclohexyl)-5-iodopyrimidin-2-amine |
|---|---|
| PubChem CID | 116648422 |
| Molecular Formula | C12H18IN3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-5-iodopyrimidin-2-amine |
| SMILES | CC1CC(C)CC(Nc2ncc(I)cn2)C1 |
| InChI | InChI=1S/C12H18IN3/c1-8-3-9(2)5-11(4-8)16-12-14-6-10(13)7-15-12/h6-9,11H,3-5H2,1-2H3,(H,14,15,16) |
| InChIKey | RVYKHUUJNFGQEI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|