C12H19N3 — CID 107587637
N-(3,5-dimethylcyclohexyl)pyrimidin-5-amine (PubChem CID 107587637) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)pyrimidin-5-amine.
| Compound Name | N-(3,5-dimethylcyclohexyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 107587637 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)pyrimidin-5-amine |
| SMILES | CC1CC(C)CC(Nc2cncnc2)C1 |
| InChI | InChI=1S/C12H19N3/c1-9-3-10(2)5-11(4-9)15-12-6-13-8-14-7-12/h6-11,15H,3-5H2,1-2H3 |
| InChIKey | BJHFPWBDEWGEQF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |