About 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one
5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one (PubChem CID 66275820) has the molecular formula C8H14N6O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one |
| PubChem CID | 66275820 |
| Molecular Formula | C8H14N6O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one |
| SMILES | CN1CC(Nc2n[nH]c(N)n2)CCC1=O |
| InChI | InChI=1S/C8H14N6O/c1-14-4-5(2-3-6(14)15)10-8-11-7(9)12-13-8/h5H,2-4H2,1H3,(H4,9,10,11,12,13) |
| InChIKey | JAWZIMTZUULAMA-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one?
The IUPAC name of 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one (CID 66275820) is 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one.
What is the SMILES notation for 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one?
The canonical SMILES for 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one is CN1CC(Nc2n[nH]c(N)n2)CCC1=O.
What is the InChIKey of 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one?
The InChIKey is JAWZIMTZUULAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N6O/c1-14-4-5(2-3-6(14)15)10-8-11-7(9)12-13-8/h5H,2-4H2,1H3,(H4,9,10,11,12,13).
What are the key properties of 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one?
5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one has a molecular weight of 210.24 g/mol, XLogP of -0.58, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-1-methylpiperidin-2-one is sourced from PubChem (CID 66275820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).