C12H19N3O3S2 — CID 47387426
1-propylsulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 47387426) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 1-propylsulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-propylsulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 47387426 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-propylsulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCC(C(=O)Nc2nccs2)CC1 |
| InChI | InChI=1S/C12H19N3O3S2/c1-2-9-20(17,18)15-6-3-10(4-7-15)11(16)14-12-13-5-8-19-12/h5,8,10H,2-4,6-7,9H2,1H3,(H,13,14,16) |
| InChIKey | NGDFLWQPOJYCET-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |