C18H23N3O2S — CID 51092852
1-[(2-hydroxy-4,5-dimethylphenyl)methyl]-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 51092852) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[(2-hydroxy-4,5-dimethylphenyl)methyl]-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-[(2-hydroxy-4,5-dimethylphenyl)methyl]-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51092852 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[(2-hydroxy-4,5-dimethylphenyl)methyl]-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | Cc1cc(O)c(CN2CCC(C(=O)Nc3nccs3)CC2)cc1C |
| InChI | InChI=1S/C18H23N3O2S/c1-12-9-15(16(22)10-13(12)2)11-21-6-3-14(4-7-21)17(23)20-18-19-5-8-24-18/h5,8-10,14,22H,3-4,6-7,11H2,1-2H3,(H,19,20,23) |
| InChIKey | AMXSQZVXBMMBPE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|