C20H27N3O3S — CID 163177193
2-[(3S,4S)-3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 163177193) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-[(3S,4S)-3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(3S,4S)-3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 163177193 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 2-[(3S,4S)-3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CC[C@@H]1CN(Cc2ccc(OC)cc2O)CC[C@H]1CC(=O)Nc1nccs1 |
| InChI | InChI=1S/C20H27N3O3S/c1-3-14-12-23(13-16-4-5-17(26-2)11-18(16)24)8-6-15(14)10-19(25)22-20-21-7-9-27-20/h4-5,7,9,11,14-15,24H,3,6,8,10,12-13H2,1-2H3,(H,21,22,25)/t14-,15+/m1/s1 |
| InChIKey | XSTRUUDBKGTGCT-CABCVRRESA-N |
| XLogP | 3.73 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|