C16H24N2O2 — CID 82983416
5-methoxy-2-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]phenol (PubChem CID 82983416) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 5-methoxy-2-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]phenol.
| Compound Name | 5-methoxy-2-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]phenol |
|---|---|
| PubChem CID | 82983416 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 5-methoxy-2-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]phenol |
| SMILES | COc1ccc(CN2CCC3CCC(C2)N3C)c(O)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-17-13-4-5-14(17)11-18(8-7-13)10-12-3-6-15(20-2)9-16(12)19/h3,6,9,13-14,19H,4-5,7-8,10-11H2,1-2H3 |
| InChIKey | BUZOJNUKJAMAJK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|