C15H22BrN3 — CID 79174436
3-bromo-4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]aniline (PubChem CID 79174436) has the molecular formula C15H22BrN3 and a molecular weight of 324.27 g/mol. Its IUPAC name is 3-bromo-4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]aniline.
| Compound Name | 3-bromo-4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 79174436 |
| Molecular Formula | C15H22BrN3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 3-bromo-4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]aniline |
| SMILES | CN1C2CCC1CN(Cc1ccc(N)cc1Br)CC2 |
| InChI | InChI=1S/C15H22BrN3/c1-18-13-4-5-14(18)10-19(7-6-13)9-11-2-3-12(17)8-15(11)16/h2-3,8,13-14H,4-7,9-10,17H2,1H3 |
| InChIKey | ORFAFWVAGZLRAT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|