C20H32N2O4 — CID 163139330
2-[(3S,4S)-3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 163139330) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[(3S,4S)-3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(3S,4S)-3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 163139330 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-[(3S,4S)-3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CC[C@@H]1CN(Cc2ccc(OC)cc2O)CC[C@H]1CC(=O)NCCOC |
| InChI | InChI=1S/C20H32N2O4/c1-4-15-13-22(14-17-5-6-18(26-3)12-19(17)23)9-7-16(15)11-20(24)21-8-10-25-2/h5-6,12,15-16,23H,4,7-11,13-14H2,1-3H3,(H,21,24)/t15-,16+/m1/s1 |
| InChIKey | JEKPASPTTVFFMK-CVEARBPZSA-N |
| XLogP | 2.40 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|