C23H35N3O4 — CID 73149300
1-[2-[3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]acetyl]piperidine-4-carboxamide (PubChem CID 73149300) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-[2-[3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 73149300 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 1-[2-[3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]acetyl]piperidine-4-carboxamide |
| SMILES | CCC1CN(Cc2ccc(OC)cc2O)CCC1CC(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C23H35N3O4/c1-3-16-14-25(15-19-4-5-20(30-2)13-21(19)27)9-6-18(16)12-22(28)26-10-7-17(8-11-26)23(24)29/h4-5,13,16-18,27H,3,6-12,14-15H2,1-2H3,(H2,24,29) |
| InChIKey | PWCIRXZHBPFAAL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|