C23H30N2O4 — CID 73149093
2-[3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(3-hydroxyphenyl)acetamide (PubChem CID 73149093) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(3-hydroxyphenyl)acetamide.
| Compound Name | 2-[3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 73149093 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-[3-ethyl-1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-4-yl]-N-(3-hydroxyphenyl)acetamide |
| SMILES | CCC1CN(Cc2ccc(OC)cc2O)CCC1CC(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C23H30N2O4/c1-3-16-14-25(15-18-7-8-21(29-2)13-22(18)27)10-9-17(16)11-23(28)24-19-5-4-6-20(26)12-19/h4-8,12-13,16-17,26-27H,3,9-11,14-15H2,1-2H3,(H,24,28) |
| InChIKey | LGIFMZIWXOSJIE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|