C17H21N3O4S2 — CID 18082310
1-(4-ethoxyphenyl)sulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 18082310) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)sulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(4-ethoxyphenyl)sulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 18082310 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-(4-ethoxyphenyl)sulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3nccs3)CC2)cc1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-2-24-14-3-5-15(6-4-14)26(22,23)20-10-7-13(8-11-20)16(21)19-17-18-9-12-25-17/h3-6,9,12-13H,2,7-8,10-11H2,1H3,(H,18,19,21) |
| InChIKey | JIFCKRPWUXYUFD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |