C20H22F2N2O4S — CID 34169348
N-(3,5-difluorophenyl)-1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 34169348) has the molecular formula C20H22F2N2O4S and a molecular weight of 424.47 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 34169348 |
| Molecular Formula | C20H22F2N2O4S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-(3,5-difluorophenyl)-1-(4-ethoxyphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(C(=O)Nc3cc(F)cc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C20H22F2N2O4S/c1-2-28-18-3-5-19(6-4-18)29(26,27)24-9-7-14(8-10-24)20(25)23-17-12-15(21)11-16(22)13-17/h3-6,11-14H,2,7-10H2,1H3,(H,23,25) |
| InChIKey | XAQGAVFXQHUSLY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |