C12H20N4O3S2 — CID 95274519
(2S)-1-(diethylsulfamoyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 95274519) has the molecular formula C12H20N4O3S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is (2S)-1-(diethylsulfamoyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(diethylsulfamoyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95274519 |
| Molecular Formula | C12H20N4O3S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (2S)-1-(diethylsulfamoyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCC[C@H]1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H20N4O3S2/c1-3-15(4-2)21(18,19)16-8-5-6-10(16)11(17)14-12-13-7-9-20-12/h7,9-10H,3-6,8H2,1-2H3,(H,13,14,17)/t10-/m0/s1 |
| InChIKey | MPECTSGFPHFBGX-JTQLQIEISA-N |
| XLogP | 1.13 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |