C16H27N3O3S2 — CID 90618011
2-[1-(1-propylsulfonylpiperidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole (PubChem CID 90618011) has the molecular formula C16H27N3O3S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 2-[1-(1-propylsulfonylpiperidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole.
| Compound Name | 2-[1-(1-propylsulfonylpiperidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole |
|---|---|
| PubChem CID | 90618011 |
| Molecular Formula | C16H27N3O3S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[1-(1-propylsulfonylpiperidin-4-yl)piperidin-4-yl]oxy-1,3-thiazole |
| SMILES | CCCS(=O)(=O)N1CCC(N2CCC(Oc3nccs3)CC2)CC1 |
| InChI | InChI=1S/C16H27N3O3S2/c1-2-13-24(20,21)19-10-3-14(4-11-19)18-8-5-15(6-9-18)22-16-17-7-12-23-16/h7,12,14-15H,2-6,8-11,13H2,1H3 |
| InChIKey | VYDQAFPODRDTMZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |