C10H16N4 — CID 106995922
N-(2-methylpiperidin-4-yl)pyrazin-2-amine (PubChem CID 106995922) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)pyrazin-2-amine.
| Compound Name | N-(2-methylpiperidin-4-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 106995922 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)pyrazin-2-amine |
| SMILES | CC1CC(Nc2cnccn2)CCN1 |
| InChI | InChI=1S/C10H16N4/c1-8-6-9(2-3-12-8)14-10-7-11-4-5-13-10/h4-5,7-9,12H,2-3,6H2,1H3,(H,13,14) |
| InChIKey | VVDGAIMBFLJMCQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |