C11H18N4S — CID 106996340
N-(2-methylpiperidin-4-yl)-6-methylsulfanylpyrimidin-4-amine (PubChem CID 106996340) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-6-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-(2-methylpiperidin-4-yl)-6-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106996340 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-6-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1cc(NC2CCNC(C)C2)ncn1 |
| InChI | InChI=1S/C11H18N4S/c1-8-5-9(3-4-12-8)15-10-6-11(16-2)14-7-13-10/h6-9,12H,3-5H2,1-2H3,(H,13,14,15) |
| InChIKey | KBXRKYMKPCJNBI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |