About 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine
1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine (PubChem CID 106973164) has the molecular formula C8H12N4S
and a molecular weight of 196.28 g/mol. Its IUPAC name is 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine |
| PubChem CID | 106973164 |
| Molecular Formula | C8H12N4S |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine |
| SMILES | CSc1cc(NC2CC2N)ncn1 |
| InChI | InChI=1S/C8H12N4S/c1-13-8-3-7(10-4-11-8)12-6-2-5(6)9/h3-6H,2,9H2,1H3,(H,10,11,12) |
| InChIKey | NEIGQOAPTIJRBU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine?
The IUPAC name of 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine (CID 106973164) is 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine.
What is the SMILES notation for 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine?
The canonical SMILES for 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine is CSc1cc(NC2CC2N)ncn1.
What is the InChIKey of 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine?
The InChIKey is NEIGQOAPTIJRBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4S/c1-13-8-3-7(10-4-11-8)12-6-2-5(6)9/h3-6H,2,9H2,1H3,(H,10,11,12).
What are the key properties of 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine?
1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine has a molecular weight of 196.28 g/mol, XLogP of 0.71, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(6-methylsulfanylpyrimidin-4-yl)cyclopropane-1,2-diamine is sourced from PubChem (CID 106973164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).