C10H15ClN4 — CID 106996173
5-chloro-N-(2-methylpiperidin-4-yl)pyrimidin-4-amine (PubChem CID 106996173) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is 5-chloro-N-(2-methylpiperidin-4-yl)pyrimidin-4-amine.
| Compound Name | 5-chloro-N-(2-methylpiperidin-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106996173 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 5-chloro-N-(2-methylpiperidin-4-yl)pyrimidin-4-amine |
| SMILES | CC1CC(Nc2ncncc2Cl)CCN1 |
| InChI | InChI=1S/C10H15ClN4/c1-7-4-8(2-3-13-7)15-10-9(11)5-12-6-14-10/h5-8,13H,2-4H2,1H3,(H,12,14,15) |
| InChIKey | CGIGQFWLNQYXHD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |