C12H13Cl2N3S — CID 82192099
4,7-dichloro-N-piperidin-4-yl-1,3-benzothiazol-2-amine (PubChem CID 82192099) has the molecular formula C12H13Cl2N3S and a molecular weight of 302.23 g/mol. Its IUPAC name is 4,7-dichloro-N-piperidin-4-yl-1,3-benzothiazol-2-amine.
| Compound Name | 4,7-dichloro-N-piperidin-4-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82192099 |
| Molecular Formula | C12H13Cl2N3S |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 4,7-dichloro-N-piperidin-4-yl-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc(Cl)c2sc(NC3CCNCC3)nc12 |
| InChI | InChI=1S/C12H13Cl2N3S/c13-8-1-2-9(14)11-10(8)17-12(18-11)16-7-3-5-15-6-4-7/h1-2,7,15H,3-6H2,(H,16,17) |
| InChIKey | PYMMLYMRXXGUGD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |