C11H12ClN3S — CID 82192008
4-chloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine (PubChem CID 82192008) has the molecular formula C11H12ClN3S and a molecular weight of 253.76 g/mol. Its IUPAC name is 4-chloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine.
| Compound Name | 4-chloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82192008 |
| Molecular Formula | C11H12ClN3S |
| Molecular Weight | 253.76 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 4-chloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine |
| SMILES | Clc1cccc2sc(NC3CCNC3)nc12 |
| InChI | InChI=1S/C11H12ClN3S/c12-8-2-1-3-9-10(8)15-11(16-9)14-7-4-5-13-6-7/h1-3,7,13H,4-6H2,(H,14,15) |
| InChIKey | VFERYYGXBVTDNE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |