C13H16ClN3S — CID 82192094
5-chloro-4-methyl-N-piperidin-4-yl-1,3-benzothiazol-2-amine (PubChem CID 82192094) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is 5-chloro-4-methyl-N-piperidin-4-yl-1,3-benzothiazol-2-amine.
| Compound Name | 5-chloro-4-methyl-N-piperidin-4-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82192094 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-chloro-4-methyl-N-piperidin-4-yl-1,3-benzothiazol-2-amine |
| SMILES | Cc1c(Cl)ccc2sc(NC3CCNCC3)nc12 |
| InChI | InChI=1S/C13H16ClN3S/c1-8-10(14)2-3-11-12(8)17-13(18-11)16-9-4-6-15-7-5-9/h2-3,9,15H,4-7H2,1H3,(H,16,17) |
| InChIKey | ITFCLJOGQXIYTF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |