C13H14F3N3S — CID 164533286
N-piperidin-4-yl-6-(trifluoromethyl)-1,3-benzothiazol-2-amine (PubChem CID 164533286) has the molecular formula C13H14F3N3S and a molecular weight of 301.34 g/mol. Its IUPAC name is N-piperidin-4-yl-6-(trifluoromethyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-piperidin-4-yl-6-(trifluoromethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 164533286 |
| Molecular Formula | C13H14F3N3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-piperidin-4-yl-6-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| SMILES | FC(F)(F)c1ccc2nc(NC3CCNCC3)sc2c1 |
| InChI | InChI=1S/C13H14F3N3S/c14-13(15,16)8-1-2-10-11(7-8)20-12(19-10)18-9-3-5-17-6-4-9/h1-2,7,9,17H,3-6H2,(H,18,19) |
| InChIKey | YBMXFOBIDGPOPO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |