C11H9ClF3N3S — CID 140893601
N-(1-chloroazetidin-3-yl)-5-(trifluoromethyl)-1,3-benzothiazol-2-amine (PubChem CID 140893601) has the molecular formula C11H9ClF3N3S and a molecular weight of 307.73 g/mol. Its IUPAC name is N-(1-chloroazetidin-3-yl)-5-(trifluoromethyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(1-chloroazetidin-3-yl)-5-(trifluoromethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 140893601 |
| Molecular Formula | C11H9ClF3N3S |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-(1-chloroazetidin-3-yl)-5-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| SMILES | FC(F)(F)c1ccc2sc(NC3CN(Cl)C3)nc2c1 |
| InChI | InChI=1S/C11H9ClF3N3S/c12-18-4-7(5-18)16-10-17-8-3-6(11(13,14)15)1-2-9(8)19-10/h1-3,7H,4-5H2,(H,16,17) |
| InChIKey | DRZKQQZVYZUILF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|