C13H13F3N2OS2 — CID 104576581
N-(1-oxothian-4-yl)-5-(trifluoromethyl)-1,3-benzothiazol-2-amine (PubChem CID 104576581) has the molecular formula C13H13F3N2OS2 and a molecular weight of 334.39 g/mol. Its IUPAC name is N-(1-oxothian-4-yl)-5-(trifluoromethyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(1-oxothian-4-yl)-5-(trifluoromethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 104576581 |
| Molecular Formula | C13H13F3N2OS2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-(1-oxothian-4-yl)-5-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| SMILES | O=S1CCC(Nc2nc3cc(C(F)(F)F)ccc3s2)CC1 |
| InChI | InChI=1S/C13H13F3N2OS2/c14-13(15,16)8-1-2-11-10(7-8)18-12(20-11)17-9-3-5-21(19)6-4-9/h1-2,7,9H,3-6H2,(H,17,18) |
| InChIKey | NSAVZMMISYQMDV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |