C9H11ClFN3O2S — CID 79080718
2-chloro-N-(1,1-dioxothian-4-yl)-5-fluoropyrimidin-4-amine (PubChem CID 79080718) has the molecular formula C9H11ClFN3O2S and a molecular weight of 279.72 g/mol. Its IUPAC name is 2-chloro-N-(1,1-dioxothian-4-yl)-5-fluoropyrimidin-4-amine.
| Compound Name | 2-chloro-N-(1,1-dioxothian-4-yl)-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 79080718 |
| Molecular Formula | C9H11ClFN3O2S |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-chloro-N-(1,1-dioxothian-4-yl)-5-fluoropyrimidin-4-amine |
| SMILES | O=S1(=O)CCC(Nc2nc(Cl)ncc2F)CC1 |
| InChI | InChI=1S/C9H11ClFN3O2S/c10-9-12-5-7(11)8(14-9)13-6-1-3-17(15,16)4-2-6/h5-6H,1-4H2,(H,12,13,14) |
| InChIKey | DRLZNTRNBOZNEK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |