C8H10FN3O2S — CID 164634267
N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoropyrimidin-2-amine (PubChem CID 164634267) has the molecular formula C8H10FN3O2S and a molecular weight of 231.25 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoropyrimidin-2-amine.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 164634267 |
| Molecular Formula | C8H10FN3O2S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoropyrimidin-2-amine |
| SMILES | O=S1(=O)CC[C@H](Nc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C8H10FN3O2S/c9-6-3-10-8(11-4-6)12-7-1-2-15(13,14)5-7/h3-4,7H,1-2,5H2,(H,10,11,12)/t7-/m0/s1 |
| InChIKey | KHHKEPPOUSGKGB-ZETCQYMHSA-N |
| XLogP | 0.21 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |