C11H17N3O2S — CID 97210741
N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-5-ethylpyrimidin-2-amine (PubChem CID 97210741) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-5-ethylpyrimidin-2-amine.
| Compound Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-5-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 97210741 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-5-ethylpyrimidin-2-amine |
| SMILES | CCc1cnc(NC[C@H]2CCS(=O)(=O)C2)nc1 |
| InChI | InChI=1S/C11H17N3O2S/c1-2-9-5-12-11(13-6-9)14-7-10-3-4-17(15,16)8-10/h5-6,10H,2-4,7-8H2,1H3,(H,12,13,14)/t10-/m1/s1 |
| InChIKey | LXPBZXHGHACWFW-SNVBAGLBSA-N |
| XLogP | 0.89 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |