About N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine
N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine (PubChem CID 164642526) has the molecular formula C10H15N3O2S
and a molecular weight of 241.32 g/mol. Its IUPAC name is N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine |
| PubChem CID | 164642526 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine |
| SMILES | Cc1cnc(NC[C@H]2CCCS2(=O)=O)nc1 |
| InChI | InChI=1S/C10H15N3O2S/c1-8-5-11-10(12-6-8)13-7-9-3-2-4-16(9,14)15/h5-6,9H,2-4,7H2,1H3,(H,11,12,13)/t9-/m1/s1 |
| InChIKey | ZXLVDQIKSIICTR-SECBINFHSA-N |
| XLogP | 0.77 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine?
The IUPAC name of N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine (CID 164642526) is N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine.
What is the SMILES notation for N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine?
The canonical SMILES for N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine is Cc1cnc(NC[C@H]2CCCS2(=O)=O)nc1.
What is the InChIKey of N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine?
The InChIKey is ZXLVDQIKSIICTR-SECBINFHSA-N. The full InChI is InChI=1S/C10H15N3O2S/c1-8-5-11-10(12-6-8)13-7-9-3-2-4-16(9,14)15/h5-6,9H,2-4,7H2,1H3,(H,11,12,13)/t9-/m1/s1.
What are the key properties of N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine?
N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine has a molecular weight of 241.32 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]-5-methylpyrimidin-2-amine is sourced from PubChem (CID 164642526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).