C9H12ClFN4 — CID 130702728
2-chloro-N-(1-ethylazetidin-3-yl)-5-fluoropyrimidin-4-amine (PubChem CID 130702728) has the molecular formula C9H12ClFN4 and a molecular weight of 230.67 g/mol. Its IUPAC name is 2-chloro-N-(1-ethylazetidin-3-yl)-5-fluoropyrimidin-4-amine.
| Compound Name | 2-chloro-N-(1-ethylazetidin-3-yl)-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 130702728 |
| Molecular Formula | C9H12ClFN4 |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-chloro-N-(1-ethylazetidin-3-yl)-5-fluoropyrimidin-4-amine |
| SMILES | CCN1CC(Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C9H12ClFN4/c1-2-15-4-6(5-15)13-8-7(11)3-12-9(10)14-8/h3,6H,2,4-5H2,1H3,(H,12,13,14) |
| InChIKey | LRHRLQJBAURXSV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |