C9H13FN4 — CID 126987855
N-(1-ethylazetidin-3-yl)-5-fluoropyrimidin-2-amine (PubChem CID 126987855) has the molecular formula C9H13FN4 and a molecular weight of 196.23 g/mol. Its IUPAC name is N-(1-ethylazetidin-3-yl)-5-fluoropyrimidin-2-amine.
| Compound Name | N-(1-ethylazetidin-3-yl)-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 126987855 |
| Molecular Formula | C9H13FN4 |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | N-(1-ethylazetidin-3-yl)-5-fluoropyrimidin-2-amine |
| SMILES | CCN1CC(Nc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C9H13FN4/c1-2-14-5-8(6-14)13-9-11-3-7(10)4-12-9/h3-4,8H,2,5-6H2,1H3,(H,11,12,13) |
| InChIKey | XQPVDNDYGDPPMK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |