C10H12BrN3 — CID 43599084
N-(5-bromo-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-amine (PubChem CID 43599084) has the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-amine.
| Compound Name | N-(5-bromo-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-amine |
|---|---|
| PubChem CID | 43599084 |
| Molecular Formula | C10H12BrN3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-amine |
| SMILES | Brc1ccc(NC2C3CNCC32)nc1 |
| InChI | InChI=1S/C10H12BrN3/c11-6-1-2-9(13-3-6)14-10-7-4-12-5-8(7)10/h1-3,7-8,10,12H,4-5H2,(H,13,14) |
| InChIKey | DAKAXEIQABESGA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |